Questions: Let's start by balancing the following chemical reaction fill in blank C2H5OH(l)+ fill in blank O2(g) → fill in blank. CO2(g)+ fill in blank H2O(g)

Let's start by balancing the following chemical reaction
fill in blank C2H5OH(l)+ fill in blank O2(g) → fill in blank. CO2(g)+ fill in blank H2O(g)
Transcript text: Lets start by balancing the following chemical reaction fill in blank $\quad \mathrm{C}_{2} \mathrm{H}_{5} \mathrm{OH}(l)+$ fill in blank $\quad \mathrm{O}_{2}(\mathrm{~g}) \rightarrow$ fill in blank. $\mathrm{CO}_{2}(\mathrm{~g})+$ fill in blank $\mathrm{H}_{2} \mathrm{O}(\mathrm{g})$
failed

Solution

failed
failed

Solution Steps

Step 1: Write the Unbalanced Chemical Equation

The unbalanced chemical equation for the combustion of ethanol (C2H5OH\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) is: C2H5OH(l)+O2(g)CO2(g)+H2O(g) \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + \mathrm{O}_2(g) \rightarrow \mathrm{CO}_2(g) + \mathrm{H}_2\mathrm{O}(g)

Step 2: Balance the Carbon Atoms

Ethanol contains 2 carbon atoms, so we need 2 CO2\mathrm{CO}_2 molecules on the product side: C2H5OH(l)+O2(g)2CO2(g)+H2O(g) \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + \mathrm{O}_2(g) \rightarrow 2\mathrm{CO}_2(g) + \mathrm{H}_2\mathrm{O}(g)

Step 3: Balance the Hydrogen Atoms

Ethanol contains 6 hydrogen atoms, so we need 3 H2O\mathrm{H}_2\mathrm{O} molecules on the product side: C2H5OH(l)+O2(g)2CO2(g)+3H2O(g) \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + \mathrm{O}_2(g) \rightarrow 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(g)

Step 4: Balance the Oxygen Atoms

Now, count the oxygen atoms on the product side: 2×22 \times 2 from CO2\mathrm{CO}_2 and 3×13 \times 1 from H2O\mathrm{H}_2\mathrm{O}, totaling 7 oxygen atoms. Ethanol provides 1 oxygen atom, so we need 6 more from O2\mathrm{O}_2, which means 3 O2\mathrm{O}_2 molecules: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g) \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + 3\mathrm{O}_2(g) \rightarrow 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(g)

Final Answer

The balanced chemical equation is: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g) \boxed{\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + 3\mathrm{O}_2(g) \rightarrow 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(g)}

Was this solution helpful?
failed
Unhelpful
failed
Helpful